C35H31N3O10S2 — CID 78580996
ethyl 4-[[2-[4-[(8S)-11-(4-ethoxycarbonylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]-2-methoxyphenoxy]acetyl]amino]benzoate (PubChem CID 78580996) has the molecular formula C35H31N3O10S2 and a molecular weight of 717.78 g/mol. Its IUPAC name is ethyl 4-[[2-[4-[(8S)-11-(4-ethoxycarbonylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]-2-methoxyphenoxy]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[4-[(8S)-11-(4-ethoxycarbonylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]-2-methoxyphenoxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 78580996 |
| Molecular Formula | C35H31N3O10S2 |
| Molecular Weight | 717.78 g/mol |
| Exact Mass | 717.15 |
| IUPAC Name | ethyl 4-[[2-[4-[(8S)-11-(4-ethoxycarbonylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]-2-methoxyphenoxy]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COc2ccc([C@H]3c4sc(=O)[nH]c4SC4C(=O)N(c5ccc(C(=O)OCC)cc5)C(=O)C43)cc2OC)cc1 |
| InChI | InChI=1S/C35H31N3O10S2/c1-4-46-33(42)18-6-11-21(12-7-18)36-25(39)17-48-23-15-10-20(16-24(23)45-3)26-27-29(49-30-28(26)50-35(44)37-30)32(41)38(31(27)40)22-13-8-19(9-14-22)34(43)47-5-2/h6-16,26-27,29H,4-5,17H2,1-3H3,(H,36,39)(H,37,44)/t26-,27?,29?/m1/s1 |
| InChIKey | SKFRPKFQLUYXJY-JTENNJLISA-N |
| XLogP | 4.61 |
| TPSA | 170.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.78 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|