C33H30N4O10S3 — CID 19254370
ethyl 4-[(1R,8R,9R)-8-[3-ethoxy-4-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 19254370) has the molecular formula C33H30N4O10S3 and a molecular weight of 738.82 g/mol. Its IUPAC name is ethyl 4-[(1R,8R,9R)-8-[3-ethoxy-4-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(1R,8R,9R)-8-[3-ethoxy-4-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 19254370 |
| Molecular Formula | C33H30N4O10S3 |
| Molecular Weight | 738.82 g/mol |
| Exact Mass | 738.11 |
| IUPAC Name | ethyl 4-[(1R,8R,9R)-8-[3-ethoxy-4-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@H]3[C@H](c4ccc(OCC(=O)Nc5ccc(S(N)(=O)=O)cc5)c(OCC)c4)c4sc(=O)[nH]c4S[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C33H30N4O10S3/c1-3-45-23-15-18(7-14-22(23)47-16-24(38)35-19-8-12-21(13-9-19)50(34,43)44)25-26-28(48-29-27(25)49-33(42)36-29)31(40)37(30(26)39)20-10-5-17(6-11-20)32(41)46-4-2/h5-15,25-26,28H,3-4,16H2,1-2H3,(H,35,38)(H,36,42)(H2,34,43,44)/t25-,26-,28+/m0/s1 |
| InChIKey | WAFSWLPEJGQPAN-UNCTUWKVSA-N |
| XLogP | 3.47 |
| TPSA | 204.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.82 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|