C29H23BrN4O8S3 — CID 43851936
2-[4-[11-(4-bromophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]-2-methoxyphenoxy]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 43851936) has the molecular formula C29H23BrN4O8S3 and a molecular weight of 731.63 g/mol. Its IUPAC name is 2-[4-[11-(4-bromophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]-2-methoxyphenoxy]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[4-[11-(4-bromophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]-2-methoxyphenoxy]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 43851936 |
| Molecular Formula | C29H23BrN4O8S3 |
| Molecular Weight | 731.63 g/mol |
| Exact Mass | 729.99 |
| IUPAC Name | 2-[4-[11-(4-bromophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]-2-methoxyphenoxy]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | COc1cc(C2c3sc(=O)[nH]c3SC3C(=O)N(c4ccc(Br)cc4)C(=O)C32)ccc1OCC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C29H23BrN4O8S3/c1-41-20-12-14(2-11-19(20)42-13-21(35)32-16-5-9-18(10-6-16)45(31,39)40)22-23-25(43-26-24(22)44-29(38)33-26)28(37)34(27(23)36)17-7-3-15(30)4-8-17/h2-12,22-23,25H,13H2,1H3,(H,32,35)(H,33,38)(H2,31,39,40) |
| InChIKey | QFOROXTWJUWMQG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 177.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.63 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|