C33H26F3N3O8S2 — CID 19254356
ethyl 4-[(1R,8R,9R)-8-[3-methoxy-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 19254356) has the molecular formula C33H26F3N3O8S2 and a molecular weight of 713.71 g/mol. Its IUPAC name is ethyl 4-[(1R,8R,9R)-8-[3-methoxy-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(1R,8R,9R)-8-[3-methoxy-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 19254356 |
| Molecular Formula | C33H26F3N3O8S2 |
| Molecular Weight | 713.71 g/mol |
| Exact Mass | 713.11 |
| IUPAC Name | ethyl 4-[(1R,8R,9R)-8-[3-methoxy-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@H]3[C@H](c4ccc(OCC(=O)Nc5ccccc5C(F)(F)F)c(OC)c4)c4sc(=O)[nH]c4S[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C33H26F3N3O8S2/c1-3-46-31(43)16-8-11-18(12-9-16)39-29(41)25-24(26-28(38-32(44)49-26)48-27(25)30(39)42)17-10-13-21(22(14-17)45-2)47-15-23(40)37-20-7-5-4-6-19(20)33(34,35)36/h4-14,24-25,27H,3,15H2,1-2H3,(H,37,40)(H,38,44)/t24-,25-,27+/m0/s1 |
| InChIKey | PGIHBQXADFYYFO-OHSXHVKISA-N |
| XLogP | 5.45 |
| TPSA | 144.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.71 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|