C38H28F3N3O5S2 — CID 78581852
N-naphthalen-1-yl-2-[4-[(9S)-6,13,15-trioxo-14-[3-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide (PubChem CID 78581852) has the molecular formula C38H28F3N3O5S2 and a molecular weight of 727.79 g/mol. Its IUPAC name is N-naphthalen-1-yl-2-[4-[(9S)-6,13,15-trioxo-14-[3-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide.
| Compound Name | N-naphthalen-1-yl-2-[4-[(9S)-6,13,15-trioxo-14-[3-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 78581852 |
| Molecular Formula | C38H28F3N3O5S2 |
| Molecular Weight | 727.79 g/mol |
| Exact Mass | 727.14 |
| IUPAC Name | N-naphthalen-1-yl-2-[4-[(9S)-6,13,15-trioxo-14-[3-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide |
| SMILES | O=C(COc1ccc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(c6cccc(C(F)(F)F)c6)C(=O)C45)C23)cc1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C38H28F3N3O5S2/c39-38(40,41)20-7-4-8-21(15-20)44-35(46)30-24-16-25(31(30)36(44)47)32-29(24)28(33-34(50-32)43-37(48)51-33)19-11-13-22(14-12-19)49-17-27(45)42-26-10-3-6-18-5-1-2-9-23(18)26/h1-15,24-25,28-32H,16-17H2,(H,42,45)(H,43,48) |
| InChIKey | AWPBYUKHKVUDMX-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.79 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|