C34H26F3N3O5S2 — CID 43851030
N-phenyl-2-[3-[(1R,9S,11S)-6,13,15-trioxo-14-[3-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide (PubChem CID 43851030) has the molecular formula C34H26F3N3O5S2 and a molecular weight of 677.73 g/mol. Its IUPAC name is N-phenyl-2-[3-[(1R,9S,11S)-6,13,15-trioxo-14-[3-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide.
| Compound Name | N-phenyl-2-[3-[(1R,9S,11S)-6,13,15-trioxo-14-[3-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 43851030 |
| Molecular Formula | C34H26F3N3O5S2 |
| Molecular Weight | 677.73 g/mol |
| Exact Mass | 677.13 |
| IUPAC Name | N-phenyl-2-[3-[(1R,9S,11S)-6,13,15-trioxo-14-[3-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide |
| SMILES | O=C(COc1cccc([C@H]2c3sc(=O)[nH]c3SC3C2[C@H]2C[C@@H]3C3C(=O)N(c4cccc(C(F)(F)F)c4)C(=O)C32)c1)Nc1ccccc1 |
| InChI | InChI=1S/C34H26F3N3O5S2/c35-34(36,37)17-7-5-10-19(13-17)40-31(42)26-21-14-22(27(26)32(40)43)28-25(21)24(29-30(46-28)39-33(44)47-29)16-6-4-11-20(12-16)45-15-23(41)38-18-8-2-1-3-9-18/h1-13,21-22,24-28H,14-15H2,(H,38,41)(H,39,44)/t21-,22-,24-,25?,26?,27?,28?/m1/s1 |
| InChIKey | UHPAAZBMXIESJO-YINRSXHUSA-N |
| XLogP | 6.15 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.73 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|