C34H25ClF3N3O5S2 — CID 78582057
N-(4-chlorophenyl)-2-[3-[(9S)-6,13,15-trioxo-14-[3-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide (PubChem CID 78582057) has the molecular formula C34H25ClF3N3O5S2 and a molecular weight of 712.17 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[3-[(9S)-6,13,15-trioxo-14-[3-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[3-[(9S)-6,13,15-trioxo-14-[3-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 78582057 |
| Molecular Formula | C34H25ClF3N3O5S2 |
| Molecular Weight | 712.17 g/mol |
| Exact Mass | 711.09 |
| IUPAC Name | N-(4-chlorophenyl)-2-[3-[(9S)-6,13,15-trioxo-14-[3-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide |
| SMILES | O=C(COc1cccc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(c6cccc(C(F)(F)F)c6)C(=O)C45)C23)c1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C34H25ClF3N3O5S2/c35-17-7-9-18(10-8-17)39-23(42)14-46-20-6-1-3-15(11-20)24-25-21-13-22(28(25)47-30-29(24)48-33(45)40-30)27-26(21)31(43)41(32(27)44)19-5-2-4-16(12-19)34(36,37)38/h1-12,21-22,24-28H,13-14H2,(H,39,42)(H,40,45) |
| InChIKey | DWPCZBLMNVCEBE-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.17 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|