C33H26ClN3O6S2 — CID 78581510
2-[3-[(9S)-14-(4-chlorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-(4-hydroxyphenyl)acetamide (PubChem CID 78581510) has the molecular formula C33H26ClN3O6S2 and a molecular weight of 660.17 g/mol. Its IUPAC name is 2-[3-[(9S)-14-(4-chlorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[3-[(9S)-14-(4-chlorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 78581510 |
| Molecular Formula | C33H26ClN3O6S2 |
| Molecular Weight | 660.17 g/mol |
| Exact Mass | 659.10 |
| IUPAC Name | 2-[3-[(9S)-14-(4-chlorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-(4-hydroxyphenyl)acetamide |
| SMILES | O=C(COc1cccc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(c6ccc(Cl)cc6)C(=O)C45)C23)c1)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C33H26ClN3O6S2/c34-16-4-8-18(9-5-16)37-31(40)26-21-13-22(27(26)32(37)41)28-25(21)24(29-30(44-28)36-33(42)45-29)15-2-1-3-20(12-15)43-14-23(39)35-17-6-10-19(38)11-7-17/h1-12,21-22,24-28,38H,13-14H2,(H,35,39)(H,36,42) |
| InChIKey | NGAHVELENKZKJO-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.17 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|