C36H30FN3O7S2 — CID 43850781
ethyl 4-[(1R,9S,11S)-9-[3-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate (PubChem CID 43850781) has the molecular formula C36H30FN3O7S2 and a molecular weight of 699.78 g/mol. Its IUPAC name is ethyl 4-[(1R,9S,11S)-9-[3-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate.
| Compound Name | ethyl 4-[(1R,9S,11S)-9-[3-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
|---|---|
| PubChem CID | 43850781 |
| Molecular Formula | C36H30FN3O7S2 |
| Molecular Weight | 699.78 g/mol |
| Exact Mass | 699.15 |
| IUPAC Name | ethyl 4-[(1R,9S,11S)-9-[3-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3C(C2=O)[C@@H]2C[C@H]3C3Sc4[nH]c(=O)sc4[C@H](c4cccc(OCC(=O)Nc5ccc(F)cc5)c4)C32)cc1 |
| InChI | InChI=1S/C36H30FN3O7S2/c1-2-46-35(44)17-6-12-21(13-7-17)40-33(42)28-23-15-24(29(28)34(40)43)30-27(23)26(31-32(48-30)39-36(45)49-31)18-4-3-5-22(14-18)47-16-25(41)38-20-10-8-19(37)9-11-20/h3-14,23-24,26-30H,2,15-16H2,1H3,(H,38,41)(H,39,45)/t23-,24-,26-,27?,28?,29?,30?/m1/s1 |
| InChIKey | FFIAAXXJPZQTMP-XSLZJZMOSA-N |
| XLogP | 5.45 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.78 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|