C34H28FN3O5S2 — CID 78579107
N-(4-fluorophenyl)-2-[4-[(9S)-14-(4-methylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide (PubChem CID 78579107) has the molecular formula C34H28FN3O5S2 and a molecular weight of 641.75 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[4-[(9S)-14-(4-methylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[4-[(9S)-14-(4-methylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 78579107 |
| Molecular Formula | C34H28FN3O5S2 |
| Molecular Weight | 641.75 g/mol |
| Exact Mass | 641.15 |
| IUPAC Name | N-(4-fluorophenyl)-2-[4-[(9S)-14-(4-methylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide |
| SMILES | Cc1ccc(N2C(=O)C3C4CC(C3C2=O)C2C(c3ccc(OCC(=O)Nc5ccc(F)cc5)cc3)c3sc(=O)[nH]c3SC42)cc1 |
| InChI | InChI=1S/C34H28FN3O5S2/c1-16-2-10-20(11-3-16)38-32(40)27-22-14-23(28(27)33(38)41)29-26(22)25(30-31(44-29)37-34(42)45-30)17-4-12-21(13-5-17)43-15-24(39)36-19-8-6-18(35)7-9-19/h2-13,22-23,25-29H,14-15H2,1H3,(H,36,39)(H,37,42) |
| InChIKey | RZPPWRVCTIUPTD-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.75 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|