C33H26FN3O5S2 — CID 43851516
2-[4-[(1R,9S,11S)-14-(4-fluorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-phenylacetamide (PubChem CID 43851516) has the molecular formula C33H26FN3O5S2 and a molecular weight of 627.72 g/mol. Its IUPAC name is 2-[4-[(1R,9S,11S)-14-(4-fluorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-[(1R,9S,11S)-14-(4-fluorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 43851516 |
| Molecular Formula | C33H26FN3O5S2 |
| Molecular Weight | 627.72 g/mol |
| Exact Mass | 627.13 |
| IUPAC Name | 2-[4-[(1R,9S,11S)-14-(4-fluorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-phenylacetamide |
| SMILES | O=C(COc1ccc([C@H]2c3sc(=O)[nH]c3SC3C2[C@H]2C[C@@H]3C3C(=O)N(c4ccc(F)cc4)C(=O)C32)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C33H26FN3O5S2/c34-17-8-10-19(11-9-17)37-31(39)26-21-14-22(27(26)32(37)40)28-25(21)24(29-30(43-28)36-33(41)44-29)16-6-12-20(13-7-16)42-15-23(38)35-18-4-2-1-3-5-18/h1-13,21-22,24-28H,14-15H2,(H,35,38)(H,36,41)/t21-,22-,24-,25?,26?,27?,28?/m1/s1 |
| InChIKey | CKJTTWAPQLKKJS-YINRSXHUSA-N |
| XLogP | 5.27 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.72 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|