C36H29Cl2N3O7S2 — CID 78581288
ethyl 4-[(9S)-9-[3-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate (PubChem CID 78581288) has the molecular formula C36H29Cl2N3O7S2 and a molecular weight of 750.68 g/mol. Its IUPAC name is ethyl 4-[(9S)-9-[3-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate.
| Compound Name | ethyl 4-[(9S)-9-[3-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
|---|---|
| PubChem CID | 78581288 |
| Molecular Formula | C36H29Cl2N3O7S2 |
| Molecular Weight | 750.68 g/mol |
| Exact Mass | 749.08 |
| IUPAC Name | ethyl 4-[(9S)-9-[3-[2-(3,4-dichloroanilino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3C4CC(C3C2=O)C2C(c3cccc(OCC(=O)Nc5ccc(Cl)c(Cl)c5)c3)c3sc(=O)[nH]c3SC42)cc1 |
| InChI | InChI=1S/C36H29Cl2N3O7S2/c1-2-47-35(45)16-6-9-19(10-7-16)41-33(43)28-21-14-22(29(28)34(41)44)30-27(21)26(31-32(49-30)40-36(46)50-31)17-4-3-5-20(12-17)48-15-25(42)39-18-8-11-23(37)24(38)13-18/h3-13,21-22,26-30H,2,14-15H2,1H3,(H,39,42)(H,40,46) |
| InChIKey | AVOWQENSVJPOJN-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.68 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|