C34H27Cl2N3O6S2 — CID 78581219
N-(3,4-dichlorophenyl)-2-[4-[(9S)-14-(4-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide (PubChem CID 78581219) has the molecular formula C34H27Cl2N3O6S2 and a molecular weight of 708.64 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[4-[(9S)-14-(4-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[4-[(9S)-14-(4-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 78581219 |
| Molecular Formula | C34H27Cl2N3O6S2 |
| Molecular Weight | 708.64 g/mol |
| Exact Mass | 707.07 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[4-[(9S)-14-(4-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide |
| SMILES | COc1ccc(N2C(=O)C3C4CC(C3C2=O)C2C(c3ccc(OCC(=O)Nc5ccc(Cl)c(Cl)c5)cc3)c3sc(=O)[nH]c3SC42)cc1 |
| InChI | InChI=1S/C34H27Cl2N3O6S2/c1-44-18-9-5-17(6-10-18)39-32(41)27-20-13-21(28(27)33(39)42)29-26(20)25(30-31(46-29)38-34(43)47-30)15-2-7-19(8-3-15)45-14-24(40)37-16-4-11-22(35)23(36)12-16/h2-12,20-21,25-29H,13-14H2,1H3,(H,37,40)(H,38,43) |
| InChIKey | DNKWBZUQUXNQCX-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.64 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|