C37H32ClN3O8S2 — CID 78581837
ethyl 4-[(9S)-9-[4-[2-(4-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate (PubChem CID 78581837) has the molecular formula C37H32ClN3O8S2 and a molecular weight of 746.26 g/mol. Its IUPAC name is ethyl 4-[(9S)-9-[4-[2-(4-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate.
| Compound Name | ethyl 4-[(9S)-9-[4-[2-(4-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
|---|---|
| PubChem CID | 78581837 |
| Molecular Formula | C37H32ClN3O8S2 |
| Molecular Weight | 746.26 g/mol |
| Exact Mass | 745.13 |
| IUPAC Name | ethyl 4-[(9S)-9-[4-[2-(4-chloroanilino)-2-oxoethoxy]-3-methoxyphenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3C4CC(C3C2=O)C2C(c3ccc(OCC(=O)Nc5ccc(Cl)cc5)c(OC)c3)c3sc(=O)[nH]c3SC42)cc1 |
| InChI | InChI=1S/C37H32ClN3O8S2/c1-3-48-36(45)17-4-11-21(12-5-17)41-34(43)29-22-15-23(30(29)35(41)44)31-28(22)27(32-33(50-31)40-37(46)51-32)18-6-13-24(25(14-18)47-2)49-16-26(42)39-20-9-7-19(38)8-10-20/h4-14,22-23,27-31H,3,15-16H2,1-2H3,(H,39,42)(H,40,46) |
| InChIKey | ZTEPRBTWAINFSE-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 144.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.26 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|