C34H29N3O5S2 — CID 43851295
N-(2-methylphenyl)-2-[3-[(1R,9S,11S)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide (PubChem CID 43851295) has the molecular formula C34H29N3O5S2 and a molecular weight of 623.76 g/mol. Its IUPAC name is N-(2-methylphenyl)-2-[3-[(1R,9S,11S)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide.
| Compound Name | N-(2-methylphenyl)-2-[3-[(1R,9S,11S)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 43851295 |
| Molecular Formula | C34H29N3O5S2 |
| Molecular Weight | 623.76 g/mol |
| Exact Mass | 623.15 |
| IUPAC Name | N-(2-methylphenyl)-2-[3-[(1R,9S,11S)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetamide |
| SMILES | Cc1ccccc1NC(=O)COc1cccc([C@H]2c3sc(=O)[nH]c3SC3C2[C@H]2C[C@@H]3C3C(=O)N(c4ccccc4)C(=O)C32)c1 |
| InChI | InChI=1S/C34H29N3O5S2/c1-17-8-5-6-13-23(17)35-24(38)16-42-20-12-7-9-18(14-20)25-26-21-15-22(29(26)43-31-30(25)44-34(41)36-31)28-27(21)32(39)37(33(28)40)19-10-3-2-4-11-19/h2-14,21-22,25-29H,15-16H2,1H3,(H,35,38)(H,36,41)/t21-,22-,25-,26?,27?,28?,29?/m1/s1 |
| InChIKey | NZPGDJSDILMYRT-RKYYBZCTSA-N |
| XLogP | 5.44 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.76 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|