C34H32F3N3O7S2 — CID 19255718
6-[(9S)-6,13,15-trioxo-9-[3-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid (PubChem CID 19255718) has the molecular formula C34H32F3N3O7S2 and a molecular weight of 715.77 g/mol. Its IUPAC name is 6-[(9S)-6,13,15-trioxo-9-[3-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid.
| Compound Name | 6-[(9S)-6,13,15-trioxo-9-[3-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid |
|---|---|
| PubChem CID | 19255718 |
| Molecular Formula | C34H32F3N3O7S2 |
| Molecular Weight | 715.77 g/mol |
| Exact Mass | 715.16 |
| IUPAC Name | 6-[(9S)-6,13,15-trioxo-9-[3-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)C2C3CC(C2C1=O)C1C(c2cccc(OCC(=O)Nc4cccc(C(F)(F)F)c4)c2)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C34H32F3N3O7S2/c35-34(36,37)17-7-5-8-18(13-17)38-22(41)15-47-19-9-4-6-16(12-19)24-25-20-14-21(28(25)48-30-29(24)49-33(46)39-30)27-26(20)31(44)40(32(27)45)11-3-1-2-10-23(42)43/h4-9,12-13,20-21,24-28H,1-3,10-11,14-15H2,(H,38,41)(H,39,46)(H,42,43) |
| InChIKey | XSXFMIWMXIXWHO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 145.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.77 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|