C32H28F3N3O8S2 — CID 19255250
2-[(9S)-9-[3-ethoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid (PubChem CID 19255250) has the molecular formula C32H28F3N3O8S2 and a molecular weight of 703.72 g/mol. Its IUPAC name is 2-[(9S)-9-[3-ethoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid.
| Compound Name | 2-[(9S)-9-[3-ethoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid |
|---|---|
| PubChem CID | 19255250 |
| Molecular Formula | C32H28F3N3O8S2 |
| Molecular Weight | 703.72 g/mol |
| Exact Mass | 703.13 |
| IUPAC Name | 2-[(9S)-9-[3-ethoxy-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid |
| SMILES | CCOc1cc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(CC(=O)O)C(=O)C45)C23)ccc1OCC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H28F3N3O8S2/c1-2-45-19-8-13(6-7-18(19)46-12-20(39)36-15-5-3-4-14(9-15)32(33,34)35)22-23-16-10-17(26(23)47-28-27(22)48-31(44)37-28)25-24(16)29(42)38(30(25)43)11-21(40)41/h3-9,16-17,22-26H,2,10-12H2,1H3,(H,36,39)(H,37,44)(H,40,41) |
| InChIKey | WBVCGSDNSBQFCK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 155.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.72 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|