C30H26F3N3O6S2 — CID 18851942
2-[9-(3-ethoxy-4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 18851942) has the molecular formula C30H26F3N3O6S2 and a molecular weight of 645.68 g/mol. Its IUPAC name is 2-[9-(3-ethoxy-4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[9-(3-ethoxy-4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 18851942 |
| Molecular Formula | C30H26F3N3O6S2 |
| Molecular Weight | 645.68 g/mol |
| Exact Mass | 645.12 |
| IUPAC Name | 2-[9-(3-ethoxy-4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCOc1cc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(CC(=O)Nc6cccc(C(F)(F)F)c6)C(=O)C45)C23)ccc1O |
| InChI | InChI=1S/C30H26F3N3O6S2/c1-2-42-18-8-12(6-7-17(18)37)20-21-15-10-16(24(21)43-26-25(20)44-29(41)35-26)23-22(15)27(39)36(28(23)40)11-19(38)34-14-5-3-4-13(9-14)30(31,32)33/h3-9,15-16,20-24,37H,2,10-11H2,1H3,(H,34,38)(H,35,41) |
| InChIKey | DBBBKXHFDVFLJM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.68 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|