C32H31N3O8S2 — CID 18851946
ethyl 4-[[2-[9-(3-ethoxy-4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetyl]amino]benzoate (PubChem CID 18851946) has the molecular formula C32H31N3O8S2 and a molecular weight of 649.75 g/mol. Its IUPAC name is ethyl 4-[[2-[9-(3-ethoxy-4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[9-(3-ethoxy-4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 18851946 |
| Molecular Formula | C32H31N3O8S2 |
| Molecular Weight | 649.75 g/mol |
| Exact Mass | 649.16 |
| IUPAC Name | ethyl 4-[[2-[9-(3-ethoxy-4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN2C(=O)C3C4CC(C3C2=O)C2C(c3ccc(O)c(OCC)c3)c3sc(=O)[nH]c3SC42)cc1 |
| InChI | InChI=1S/C32H31N3O8S2/c1-3-42-20-11-15(7-10-19(20)36)22-23-17-12-18(26(23)44-28-27(22)45-32(41)34-28)25-24(17)29(38)35(30(25)39)13-21(37)33-16-8-5-14(6-9-16)31(40)43-4-2/h5-11,17-18,22-26,36H,3-4,12-13H2,1-2H3,(H,33,37)(H,34,41) |
| InChIKey | OQTPADORUCRJDO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 155.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.75 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|