C21H21N3O5S2 — CID 43842165
(10S)-14-amino-9-(3-ethoxy-4-hydroxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 43842165) has the molecular formula C21H21N3O5S2 and a molecular weight of 459.55 g/mol. Its IUPAC name is (10S)-14-amino-9-(3-ethoxy-4-hydroxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (10S)-14-amino-9-(3-ethoxy-4-hydroxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 43842165 |
| Molecular Formula | C21H21N3O5S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | (10S)-14-amino-9-(3-ethoxy-4-hydroxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | CCOc1cc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(N)C(=O)C45)[C@@H]23)ccc1O |
| InChI | InChI=1S/C21H21N3O5S2/c1-2-29-11-5-7(3-4-10(11)25)12-13-8-6-9(15-14(8)19(26)24(22)20(15)27)16(13)30-18-17(12)31-21(28)23-18/h3-5,8-9,12-16,25H,2,6,22H2,1H3,(H,23,28)/t8?,9?,12?,13-,14?,15?,16?/m0/s1 |
| InChIKey | ZBGVOWQPHBZBJO-UNCZVEBSSA-N |
| XLogP | 1.89 |
| TPSA | 125.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|