C25H26N2O7S2 — CID 18861689
ethyl 2-[9-(3-ethoxy-4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate (PubChem CID 18861689) has the molecular formula C25H26N2O7S2 and a molecular weight of 530.62 g/mol. Its IUPAC name is ethyl 2-[9-(3-ethoxy-4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate.
| Compound Name | ethyl 2-[9-(3-ethoxy-4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate |
|---|---|
| PubChem CID | 18861689 |
| Molecular Formula | C25H26N2O7S2 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | ethyl 2-[9-(3-ethoxy-4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C2C3CC(C2C1=O)C1C(c2ccc(O)c(OCC)c2)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C25H26N2O7S2/c1-3-33-14-7-10(5-6-13(14)28)16-17-11-8-12(20(17)35-22-21(16)36-25(32)26-22)19-18(11)23(30)27(24(19)31)9-15(29)34-4-2/h5-7,11-12,16-20,28H,3-4,8-9H2,1-2H3,(H,26,32) |
| InChIKey | TYYGYUXVIFEUAU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 126.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|