C25H26N2O7S2 — CID 124764447
4-[(1S,2R,9S,10S,11S,12S,16R)-9-(3-ethoxy-4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid (PubChem CID 124764447) has the molecular formula C25H26N2O7S2 and a molecular weight of 530.62 g/mol. Its IUPAC name is 4-[(1S,2R,9S,10S,11S,12S,16R)-9-(3-ethoxy-4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid.
| Compound Name | 4-[(1S,2R,9S,10S,11S,12S,16R)-9-(3-ethoxy-4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid |
|---|---|
| PubChem CID | 124764447 |
| Molecular Formula | C25H26N2O7S2 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | 4-[(1S,2R,9S,10S,11S,12S,16R)-9-(3-ethoxy-4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid |
| SMILES | CCOc1cc([C@H]2c3sc(=O)[nH]c3S[C@@H]3[C@H]4C[C@@H]([C@@H]5C(=O)N(CCCC(=O)O)C(=O)[C@@H]45)[C@@H]23)ccc1O |
| InChI | InChI=1S/C25H26N2O7S2/c1-2-34-14-8-10(5-6-13(14)28)16-17-11-9-12(20(17)35-22-21(16)36-25(33)26-22)19-18(11)23(31)27(24(19)32)7-3-4-15(29)30/h5-6,8,11-12,16-20,28H,2-4,7,9H2,1H3,(H,26,33)(H,29,30)/t11-,12+,16-,17+,18+,19+,20-/m1/s1 |
| InChIKey | ZFUKKOJNNQZJMT-FRHDQWCISA-N |
| XLogP | 2.88 |
| TPSA | 137.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|