C27H30N2O7S2 — CID 19252065
6-[(9S)-9-(3-ethoxy-4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid (PubChem CID 19252065) has the molecular formula C27H30N2O7S2 and a molecular weight of 558.68 g/mol. Its IUPAC name is 6-[(9S)-9-(3-ethoxy-4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid.
| Compound Name | 6-[(9S)-9-(3-ethoxy-4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid |
|---|---|
| PubChem CID | 19252065 |
| Molecular Formula | C27H30N2O7S2 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | 6-[(9S)-9-(3-ethoxy-4-hydroxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid |
| SMILES | CCOc1cc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(CCCCCC(=O)O)C(=O)C45)C23)ccc1O |
| InChI | InChI=1S/C27H30N2O7S2/c1-2-36-16-10-12(7-8-15(16)30)18-19-13-11-14(22(19)37-24-23(18)38-27(35)28-24)21-20(13)25(33)29(26(21)34)9-5-3-4-6-17(31)32/h7-8,10,13-14,18-22,30H,2-6,9,11H2,1H3,(H,28,35)(H,31,32) |
| InChIKey | RQAKLSIRIJKHLA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 137.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|