C28H19Cl2N3O5S2 — CID 43852667
N-(3,4-dichlorophenyl)-2-[4-(5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl)phenoxy]acetamide (PubChem CID 43852667) has the molecular formula C28H19Cl2N3O5S2 and a molecular weight of 612.52 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[4-(5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl)phenoxy]acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[4-(5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 43852667 |
| Molecular Formula | C28H19Cl2N3O5S2 |
| Molecular Weight | 612.52 g/mol |
| Exact Mass | 611.01 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[4-(5,10,12-trioxo-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl)phenoxy]acetamide |
| SMILES | O=C(COc1ccc(C2c3sc(=O)[nH]c3SC3C(=O)N(c4ccccc4)C(=O)C32)cc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H19Cl2N3O5S2/c29-18-11-8-15(12-19(18)30)31-20(34)13-38-17-9-6-14(7-10-17)21-22-24(39-25-23(21)40-28(37)32-25)27(36)33(26(22)35)16-4-2-1-3-5-16/h1-12,21-22,24H,13H2,(H,31,34)(H,32,37) |
| InChIKey | YBWZGEDKSHTPHP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|