C28H18Cl2N4O7S2 — CID 19254453
N-(3,4-dichlorophenyl)-2-[4-[(1R,8R,9R)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide (PubChem CID 19254453) has the molecular formula C28H18Cl2N4O7S2 and a molecular weight of 657.51 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-[4-[(1R,8R,9R)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-[4-[(1R,8R,9R)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 19254453 |
| Molecular Formula | C28H18Cl2N4O7S2 |
| Molecular Weight | 657.51 g/mol |
| Exact Mass | 656.00 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-[4-[(1R,8R,9R)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide |
| SMILES | O=C(COc1ccc([C@@H]2c3sc(=O)[nH]c3S[C@H]3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)[C@@H]23)cc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H18Cl2N4O7S2/c29-18-10-3-14(11-19(18)30)31-20(35)12-41-17-8-1-13(2-9-17)21-22-24(42-25-23(21)43-28(38)32-25)27(37)33(26(22)36)15-4-6-16(7-5-15)34(39)40/h1-11,21-22,24H,12H2,(H,31,35)(H,32,38)/t21-,22-,24+/m0/s1 |
| InChIKey | NYCQFROHGZIZBB-WPFOTENUSA-N |
| XLogP | 5.46 |
| TPSA | 151.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|