C28H19BrCl2N2O5S2 — CID 78578492
(8S)-11-(4-bromophenyl)-8-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 78578492) has the molecular formula C28H19BrCl2N2O5S2 and a molecular weight of 678.41 g/mol. Its IUPAC name is (8S)-11-(4-bromophenyl)-8-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (8S)-11-(4-bromophenyl)-8-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 78578492 |
| Molecular Formula | C28H19BrCl2N2O5S2 |
| Molecular Weight | 678.41 g/mol |
| Exact Mass | 675.93 |
| IUPAC Name | (8S)-11-(4-bromophenyl)-8-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | COc1cc([C@H]2c3sc(=O)[nH]c3SC3C(=O)N(c4ccc(Br)cc4)C(=O)C32)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H19BrCl2N2O5S2/c1-37-20-10-13(3-9-19(20)38-12-14-2-6-16(30)11-18(14)31)21-22-24(39-25-23(21)40-28(36)32-25)27(35)33(26(22)34)17-7-4-15(29)5-8-17/h2-11,21-22,24H,12H2,1H3,(H,32,36)/t21-,22?,24?/m1/s1 |
| InChIKey | HAWHMDQGWLBPOY-ZLHNRXBCSA-N |
| XLogP | 6.89 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.41 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|