C29H23BrN2O5S2 — CID 43849863
11-(4-bromophenyl)-8-[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 43849863) has the molecular formula C29H23BrN2O5S2 and a molecular weight of 623.55 g/mol. Its IUPAC name is 11-(4-bromophenyl)-8-[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | 11-(4-bromophenyl)-8-[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 43849863 |
| Molecular Formula | C29H23BrN2O5S2 |
| Molecular Weight | 623.55 g/mol |
| Exact Mass | 622.02 |
| IUPAC Name | 11-(4-bromophenyl)-8-[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | COc1cc(C2c3sc(=O)[nH]c3SC3C(=O)N(c4ccc(Br)cc4)C(=O)C32)ccc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C29H23BrN2O5S2/c1-15-3-5-16(6-4-15)14-37-20-12-7-17(13-21(20)36-2)22-23-25(38-26-24(22)39-29(35)31-26)28(34)32(27(23)33)19-10-8-18(30)9-11-19/h3-13,22-23,25H,14H2,1-2H3,(H,31,35) |
| InChIKey | ANZMMDNBNOZKRH-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.55 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|