C22H17BrN2O6S2 — CID 43849851
11-(4-bromophenyl)-8-(4-hydroxy-3,5-dimethoxyphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 43849851) has the molecular formula C22H17BrN2O6S2 and a molecular weight of 549.42 g/mol. Its IUPAC name is 11-(4-bromophenyl)-8-(4-hydroxy-3,5-dimethoxyphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | 11-(4-bromophenyl)-8-(4-hydroxy-3,5-dimethoxyphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 43849851 |
| Molecular Formula | C22H17BrN2O6S2 |
| Molecular Weight | 549.42 g/mol |
| Exact Mass | 547.97 |
| IUPAC Name | 11-(4-bromophenyl)-8-(4-hydroxy-3,5-dimethoxyphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | COc1cc(C2c3sc(=O)[nH]c3SC3C(=O)N(c4ccc(Br)cc4)C(=O)C32)cc(OC)c1O |
| InChI | InChI=1S/C22H17BrN2O6S2/c1-30-12-7-9(8-13(31-2)16(12)26)14-15-18(32-19-17(14)33-22(29)24-19)21(28)25(20(15)27)11-5-3-10(23)4-6-11/h3-8,14-15,18,26H,1-2H3,(H,24,29) |
| InChIKey | QAZMHJZMQXCEQN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|