C24H21BrN2O3S2 — CID 78578603
(8S)-11-(4-bromophenyl)-8-(4-tert-butylphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 78578603) has the molecular formula C24H21BrN2O3S2 and a molecular weight of 529.48 g/mol. Its IUPAC name is (8S)-11-(4-bromophenyl)-8-(4-tert-butylphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (8S)-11-(4-bromophenyl)-8-(4-tert-butylphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 78578603 |
| Molecular Formula | C24H21BrN2O3S2 |
| Molecular Weight | 529.48 g/mol |
| Exact Mass | 528.02 |
| IUPAC Name | (8S)-11-(4-bromophenyl)-8-(4-tert-butylphenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | CC(C)(C)c1ccc([C@H]2c3sc(=O)[nH]c3SC3C(=O)N(c4ccc(Br)cc4)C(=O)C32)cc1 |
| InChI | InChI=1S/C24H21BrN2O3S2/c1-24(2,3)13-6-4-12(5-7-13)16-17-19(31-20-18(16)32-23(30)26-20)22(29)27(21(17)28)15-10-8-14(25)9-11-15/h4-11,16-17,19H,1-3H3,(H,26,30)/t16-,17?,19?/m1/s1 |
| InChIKey | CWFASBAXEGTEOI-LRYGQEGESA-N |
| XLogP | 5.29 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|