C22H15F3N2O3S2 — CID 51579009
(1S,8S,9S)-8-(4-methylphenyl)-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 51579009) has the molecular formula C22H15F3N2O3S2 and a molecular weight of 476.50 g/mol. Its IUPAC name is (1S,8S,9S)-8-(4-methylphenyl)-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (1S,8S,9S)-8-(4-methylphenyl)-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 51579009 |
| Molecular Formula | C22H15F3N2O3S2 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | (1S,8S,9S)-8-(4-methylphenyl)-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | Cc1ccc([C@H]2c3sc(=O)[nH]c3S[C@@H]3C(=O)N(c4cccc(C(F)(F)F)c4)C(=O)[C@H]23)cc1 |
| InChI | InChI=1S/C22H15F3N2O3S2/c1-10-5-7-11(8-6-10)14-15-17(31-18-16(14)32-21(30)26-18)20(29)27(19(15)28)13-4-2-3-12(9-13)22(23,24)25/h2-9,14-15,17H,1H3,(H,26,30)/t14-,15-,17+/m1/s1 |
| InChIKey | KBTZJIFIWCYOIG-INMHGKMJSA-N |
| XLogP | 4.56 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|