C21H15BrN2O4S3 — CID 98156924
(1R,8R,9S)-11-(4-bromophenyl)-8-(4-hydroxy-3-methoxyphenyl)-5-sulfanylidene-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-10,12-dione (PubChem CID 98156924) has the molecular formula C21H15BrN2O4S3 and a molecular weight of 535.47 g/mol. Its IUPAC name is (1R,8R,9S)-11-(4-bromophenyl)-8-(4-hydroxy-3-methoxyphenyl)-5-sulfanylidene-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-10,12-dione.
| Compound Name | (1R,8R,9S)-11-(4-bromophenyl)-8-(4-hydroxy-3-methoxyphenyl)-5-sulfanylidene-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-10,12-dione |
|---|---|
| PubChem CID | 98156924 |
| Molecular Formula | C21H15BrN2O4S3 |
| Molecular Weight | 535.47 g/mol |
| Exact Mass | 533.94 |
| IUPAC Name | (1R,8R,9S)-11-(4-bromophenyl)-8-(4-hydroxy-3-methoxyphenyl)-5-sulfanylidene-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-10,12-dione |
| SMILES | COc1cc([C@@H]2c3sc(=S)[nH]c3S[C@H]3C(=O)N(c4ccc(Br)cc4)C(=O)[C@H]23)ccc1O |
| InChI | InChI=1S/C21H15BrN2O4S3/c1-28-13-8-9(2-7-12(13)25)14-15-17(30-18-16(14)31-21(29)23-18)20(27)24(19(15)26)11-5-3-10(22)4-6-11/h2-8,14-15,17,25H,1H3,(H,23,29)/t14-,15+,17+/m0/s1 |
| InChIKey | AFIUQMHIBIXQDP-ZMSDIMECSA-N |
| XLogP | 5.08 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|