C23H20N2O4S3 — CID 35581235
(1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-methylphenyl)-5-sulfanylidene-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-10,12-dione (PubChem CID 35581235) has the molecular formula C23H20N2O4S3 and a molecular weight of 484.62 g/mol. Its IUPAC name is (1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-methylphenyl)-5-sulfanylidene-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-10,12-dione.
| Compound Name | (1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-methylphenyl)-5-sulfanylidene-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-10,12-dione |
|---|---|
| PubChem CID | 35581235 |
| Molecular Formula | C23H20N2O4S3 |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | (1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-methylphenyl)-5-sulfanylidene-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-10,12-dione |
| SMILES | COc1ccc([C@@H]2c3sc(=S)[nH]c3S[C@H]3C(=O)N(c4ccc(C)cc4)C(=O)[C@@H]23)cc1OC |
| InChI | InChI=1S/C23H20N2O4S3/c1-11-4-7-13(8-5-11)25-21(26)17-16(12-6-9-14(28-2)15(10-12)29-3)18-20(24-23(30)32-18)31-19(17)22(25)27/h4-10,16-17,19H,1-3H3,(H,24,30)/t16-,17-,19+/m0/s1 |
| InChIKey | UUWIJCAKRPTJOW-JENIJYKNSA-N |
| XLogP | 4.93 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|