C22H18N2O3S3 — CID 122375077
(1S,8R,9S)-8-(4-ethoxyphenyl)-11-phenyl-5-sulfanylidene-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-10,12-dione (PubChem CID 122375077) has the molecular formula C22H18N2O3S3 and a molecular weight of 454.60 g/mol. Its IUPAC name is (1S,8R,9S)-8-(4-ethoxyphenyl)-11-phenyl-5-sulfanylidene-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-10,12-dione.
| Compound Name | (1S,8R,9S)-8-(4-ethoxyphenyl)-11-phenyl-5-sulfanylidene-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-10,12-dione |
|---|---|
| PubChem CID | 122375077 |
| Molecular Formula | C22H18N2O3S3 |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | (1S,8R,9S)-8-(4-ethoxyphenyl)-11-phenyl-5-sulfanylidene-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-10,12-dione |
| SMILES | CCOc1ccc([C@@H]2c3sc(=S)[nH]c3S[C@@H]3C(=O)N(c4ccccc4)C(=O)[C@H]23)cc1 |
| InChI | InChI=1S/C22H18N2O3S3/c1-2-27-14-10-8-12(9-11-14)15-16-18(29-19-17(15)30-22(28)23-19)21(26)24(20(16)25)13-6-4-3-5-7-13/h3-11,15-16,18H,2H2,1H3,(H,23,28)/t15-,16+,18-/m0/s1 |
| InChIKey | UYFGCWGARIITGC-JZXOWHBKSA-N |
| XLogP | 5.00 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|