C22H18N2O5S2 — CID 19251641
(1R,8R,9R)-8-(3-ethoxy-4-hydroxyphenyl)-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 19251641) has the molecular formula C22H18N2O5S2 and a molecular weight of 454.53 g/mol. Its IUPAC name is (1R,8R,9R)-8-(3-ethoxy-4-hydroxyphenyl)-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (1R,8R,9R)-8-(3-ethoxy-4-hydroxyphenyl)-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 19251641 |
| Molecular Formula | C22H18N2O5S2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | (1R,8R,9R)-8-(3-ethoxy-4-hydroxyphenyl)-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | CCOc1cc([C@@H]2c3sc(=O)[nH]c3S[C@H]3C(=O)N(c4ccccc4)C(=O)[C@@H]23)ccc1O |
| InChI | InChI=1S/C22H18N2O5S2/c1-2-29-14-10-11(8-9-13(14)25)15-16-18(30-19-17(15)31-22(28)23-19)21(27)24(20(16)26)12-6-4-3-5-7-12/h3-10,15-16,18,25H,2H2,1H3,(H,23,28)/t15-,16-,18+/m0/s1 |
| InChIKey | XPSBXCPKNNMBGL-XYJFISCASA-N |
| XLogP | 3.34 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|