C35H30N2O5S3 — CID 18865881
ethyl 4-[13,15-dioxo-9-(3-phenylmethoxyphenyl)-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate (PubChem CID 18865881) has the molecular formula C35H30N2O5S3 and a molecular weight of 654.84 g/mol. Its IUPAC name is ethyl 4-[13,15-dioxo-9-(3-phenylmethoxyphenyl)-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate.
| Compound Name | ethyl 4-[13,15-dioxo-9-(3-phenylmethoxyphenyl)-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
|---|---|
| PubChem CID | 18865881 |
| Molecular Formula | C35H30N2O5S3 |
| Molecular Weight | 654.84 g/mol |
| Exact Mass | 654.13 |
| IUPAC Name | ethyl 4-[13,15-dioxo-9-(3-phenylmethoxyphenyl)-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3C4CC(C3C2=O)C2C(c3cccc(OCc5ccccc5)c3)c3sc(=S)[nH]c3SC42)cc1 |
| InChI | InChI=1S/C35H30N2O5S3/c1-2-41-34(40)19-11-13-21(14-12-19)37-32(38)27-23-16-24(28(27)33(37)39)29-26(23)25(30-31(44-29)36-35(43)45-30)20-9-6-10-22(15-20)42-17-18-7-4-3-5-8-18/h3-15,23-29H,2,16-17H2,1H3,(H,36,43) |
| InChIKey | QNRMAQMYXWUJFA-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.84 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|