C35H30N2O6S2 — CID 43849389
ethyl 4-[(1R,11S)-6,13,15-trioxo-9-(2-phenylmethoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate (PubChem CID 43849389) has the molecular formula C35H30N2O6S2 and a molecular weight of 638.77 g/mol. Its IUPAC name is ethyl 4-[(1R,11S)-6,13,15-trioxo-9-(2-phenylmethoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate.
| Compound Name | ethyl 4-[(1R,11S)-6,13,15-trioxo-9-(2-phenylmethoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
|---|---|
| PubChem CID | 43849389 |
| Molecular Formula | C35H30N2O6S2 |
| Molecular Weight | 638.77 g/mol |
| Exact Mass | 638.15 |
| IUPAC Name | ethyl 4-[(1R,11S)-6,13,15-trioxo-9-(2-phenylmethoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3C(C2=O)[C@@H]2C[C@H]3C3Sc4[nH]c(=O)sc4C(c4ccccc4OCc4ccccc4)C32)cc1 |
| InChI | InChI=1S/C35H30N2O6S2/c1-2-42-34(40)19-12-14-20(15-13-19)37-32(38)27-22-16-23(28(27)33(37)39)29-26(22)25(30-31(44-29)36-35(41)45-30)21-10-6-7-11-24(21)43-17-18-8-4-3-5-9-18/h3-15,22-23,25-29H,2,16-17H2,1H3,(H,36,41)/t22-,23-,25?,26?,27?,28?,29?/m1/s1 |
| InChIKey | KSDPMODESJXJHM-OJSUNVOQSA-N |
| XLogP | 5.87 |
| TPSA | 105.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.77 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|