C33H25F3N2O4S2 — CID 19250800
(1R,2R,9R,10S,11S,12S,16R)-9-(2-phenylmethoxyphenyl)-14-[3-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 19250800) has the molecular formula C33H25F3N2O4S2 and a molecular weight of 634.70 g/mol. Its IUPAC name is (1R,2R,9R,10S,11S,12S,16R)-9-(2-phenylmethoxyphenyl)-14-[3-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (1R,2R,9R,10S,11S,12S,16R)-9-(2-phenylmethoxyphenyl)-14-[3-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 19250800 |
| Molecular Formula | C33H25F3N2O4S2 |
| Molecular Weight | 634.70 g/mol |
| Exact Mass | 634.12 |
| IUPAC Name | (1R,2R,9R,10S,11S,12S,16R)-9-(2-phenylmethoxyphenyl)-14-[3-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | O=C1[C@H]2[C@H]3C[C@@H]([C@@H]2C(=O)N1c1cccc(C(F)(F)F)c1)[C@H]1[C@H](c2ccccc2OCc2ccccc2)c2sc(=O)[nH]c2S[C@H]31 |
| InChI | InChI=1S/C33H25F3N2O4S2/c34-33(35,36)17-9-6-10-18(13-17)38-30(39)25-20-14-21(26(25)31(38)40)27-24(20)23(28-29(43-27)37-32(41)44-28)19-11-4-5-12-22(19)42-15-16-7-2-1-3-8-16/h1-13,20-21,23-27H,14-15H2,(H,37,41)/t20-,21-,23+,24+,25+,26+,27-/m1/s1 |
| InChIKey | WAYYOFWOLCJLDP-SUDBXQFYSA-N |
| XLogP | 6.71 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.70 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|