C32H25ClN2O4S2 — CID 43849604
(1R,11S)-9-[2-[(4-chlorophenyl)methoxy]phenyl]-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 43849604) has the molecular formula C32H25ClN2O4S2 and a molecular weight of 601.15 g/mol. Its IUPAC name is (1R,11S)-9-[2-[(4-chlorophenyl)methoxy]phenyl]-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (1R,11S)-9-[2-[(4-chlorophenyl)methoxy]phenyl]-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 43849604 |
| Molecular Formula | C32H25ClN2O4S2 |
| Molecular Weight | 601.15 g/mol |
| Exact Mass | 600.09 |
| IUPAC Name | (1R,11S)-9-[2-[(4-chlorophenyl)methoxy]phenyl]-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | O=C1C2C(C(=O)N1c1ccccc1)[C@@H]1C[C@H]2C2Sc3[nH]c(=O)sc3C(c3ccccc3OCc3ccc(Cl)cc3)C21 |
| InChI | InChI=1S/C32H25ClN2O4S2/c33-17-12-10-16(11-13-17)15-39-22-9-5-4-8-19(22)23-24-20-14-21(27(24)40-29-28(23)41-32(38)34-29)26-25(20)30(36)35(31(26)37)18-6-2-1-3-7-18/h1-13,20-21,23-27H,14-15H2,(H,34,38)/t20-,21-,23?,24?,25?,26?,27?/m1/s1 |
| InChIKey | CGDXXAZWQGWOSD-BOKKFIIESA-N |
| XLogP | 6.35 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.15 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|