C36H32N4O9S3 — CID 43850838
ethyl 4-[(1R,9S,11S)-6,13,15-trioxo-9-[2-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate (PubChem CID 43850838) has the molecular formula C36H32N4O9S3 and a molecular weight of 760.87 g/mol. Its IUPAC name is ethyl 4-[(1R,9S,11S)-6,13,15-trioxo-9-[2-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate.
| Compound Name | ethyl 4-[(1R,9S,11S)-6,13,15-trioxo-9-[2-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
|---|---|
| PubChem CID | 43850838 |
| Molecular Formula | C36H32N4O9S3 |
| Molecular Weight | 760.87 g/mol |
| Exact Mass | 760.13 |
| IUPAC Name | ethyl 4-[(1R,9S,11S)-6,13,15-trioxo-9-[2-[2-oxo-2-(4-sulfamoylanilino)ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3C(C2=O)[C@@H]2C[C@H]3C3Sc4[nH]c(=O)sc4[C@H](c4ccccc4OCC(=O)Nc4ccc(S(N)(=O)=O)cc4)C32)cc1 |
| InChI | InChI=1S/C36H32N4O9S3/c1-2-48-35(44)17-7-11-19(12-8-17)40-33(42)28-22-15-23(29(28)34(40)43)30-27(22)26(31-32(50-30)39-36(45)51-31)21-5-3-4-6-24(21)49-16-25(41)38-18-9-13-20(14-10-18)52(37,46)47/h3-14,22-23,26-30H,2,15-16H2,1H3,(H,38,41)(H,39,45)(H2,37,46,47)/t22-,23-,26-,27?,28?,29?,30?/m1/s1 |
| InChIKey | WWPUOKBYYCYFOU-CLAWKAPHSA-N |
| XLogP | 3.96 |
| TPSA | 195.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.87 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|