C33H27N5O9S3 — CID 78580988
2-[2-[(9S)-14-(4-nitrophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 78580988) has the molecular formula C33H27N5O9S3 and a molecular weight of 733.81 g/mol. Its IUPAC name is 2-[2-[(9S)-14-(4-nitrophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[2-[(9S)-14-(4-nitrophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 78580988 |
| Molecular Formula | C33H27N5O9S3 |
| Molecular Weight | 733.81 g/mol |
| Exact Mass | 733.10 |
| IUPAC Name | 2-[2-[(9S)-14-(4-nitrophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COc2ccccc2C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(c6ccc([N+](=O)[O-])cc6)C(=O)C45)C23)cc1 |
| InChI | InChI=1S/C33H27N5O9S3/c34-50(45,46)18-11-5-15(6-12-18)35-23(39)14-47-22-4-2-1-3-19(22)24-25-20-13-21(28(25)48-30-29(24)49-33(42)36-30)27-26(20)31(40)37(32(27)41)16-7-9-17(10-8-16)38(43)44/h1-12,20-21,24-28H,13-14H2,(H,35,39)(H,36,42)(H2,34,45,46) |
| InChIKey | VKVODRURKYMHFX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 211.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.81 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|