C29H25N3O8S2 — CID 19253012
ethyl 2-[2-[(1R,2R,9R,10R,11S,12S,16R)-14-(4-nitrophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetate (PubChem CID 19253012) has the molecular formula C29H25N3O8S2 and a molecular weight of 607.67 g/mol. Its IUPAC name is ethyl 2-[2-[(1R,2R,9R,10R,11S,12S,16R)-14-(4-nitrophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-[(1R,2R,9R,10R,11S,12S,16R)-14-(4-nitrophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 19253012 |
| Molecular Formula | C29H25N3O8S2 |
| Molecular Weight | 607.67 g/mol |
| Exact Mass | 607.11 |
| IUPAC Name | ethyl 2-[2-[(1R,2R,9R,10R,11S,12S,16R)-14-(4-nitrophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccccc1[C@@H]1c2sc(=O)[nH]c2S[C@@H]2[C@@H]3C[C@@H]([C@@H]4C(=O)N(c5ccc([N+](=O)[O-])cc5)C(=O)[C@@H]34)[C@H]12 |
| InChI | InChI=1S/C29H25N3O8S2/c1-2-39-19(33)12-40-18-6-4-3-5-15(18)20-21-16-11-17(24(21)41-26-25(20)42-29(36)30-26)23-22(16)27(34)31(28(23)35)13-7-9-14(10-8-13)32(37)38/h3-10,16-17,20-24H,2,11-12H2,1H3,(H,30,36)/t16-,17-,20+,21-,22+,23+,24-/m1/s1 |
| InChIKey | LEDXZQGIBIQQRA-OAXYQYSBSA-N |
| XLogP | 3.96 |
| TPSA | 148.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.67 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|