C32H30N4O7S2 — CID 78581140
(9S)-14-(4-nitrophenyl)-9-[2-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 78581140) has the molecular formula C32H30N4O7S2 and a molecular weight of 646.75 g/mol. Its IUPAC name is (9S)-14-(4-nitrophenyl)-9-[2-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (9S)-14-(4-nitrophenyl)-9-[2-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 78581140 |
| Molecular Formula | C32H30N4O7S2 |
| Molecular Weight | 646.75 g/mol |
| Exact Mass | 646.16 |
| IUPAC Name | (9S)-14-(4-nitrophenyl)-9-[2-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | O=C(COc1ccccc1C1c2sc(=O)[nH]c2SC2C3CC(C4C(=O)N(c5ccc([N+](=O)[O-])cc5)C(=O)C34)C12)N1CCCCC1 |
| InChI | InChI=1S/C32H30N4O7S2/c37-22(34-12-4-1-5-13-34)15-43-21-7-3-2-6-18(21)23-24-19-14-20(27(24)44-29-28(23)45-32(40)33-29)26-25(19)30(38)35(31(26)39)16-8-10-17(11-9-16)36(41)42/h2-3,6-11,19-20,23-27H,1,4-5,12-15H2,(H,33,40) |
| InChIKey | PJTNGUHDNNIFPZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 142.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.75 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|