C30H25F3N2O6S2 — CID 78582155
ethyl 2-[2-[(9S)-6,13,15-trioxo-14-[2-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetate (PubChem CID 78582155) has the molecular formula C30H25F3N2O6S2 and a molecular weight of 630.67 g/mol. Its IUPAC name is ethyl 2-[2-[(9S)-6,13,15-trioxo-14-[2-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-[(9S)-6,13,15-trioxo-14-[2-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 78582155 |
| Molecular Formula | C30H25F3N2O6S2 |
| Molecular Weight | 630.67 g/mol |
| Exact Mass | 630.11 |
| IUPAC Name | ethyl 2-[2-[(9S)-6,13,15-trioxo-14-[2-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccccc1C1c2sc(=O)[nH]c2SC2C3CC(C4C(=O)N(c5ccccc5C(F)(F)F)C(=O)C34)C12 |
| InChI | InChI=1S/C30H25F3N2O6S2/c1-2-40-19(36)12-41-18-10-6-3-7-13(18)20-21-14-11-15(24(21)42-26-25(20)43-29(39)34-26)23-22(14)27(37)35(28(23)38)17-9-5-4-8-16(17)30(31,32)33/h3-10,14-15,20-24H,2,11-12H2,1H3,(H,34,39) |
| InChIKey | KXEVMFRORGMKHQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 105.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.67 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|