C32H30N2O8S2 — CID 78582003
ethyl 4-[(9S)-9-[2-(2-ethoxy-2-oxoethoxy)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate (PubChem CID 78582003) has the molecular formula C32H30N2O8S2 and a molecular weight of 634.73 g/mol. Its IUPAC name is ethyl 4-[(9S)-9-[2-(2-ethoxy-2-oxoethoxy)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate.
| Compound Name | ethyl 4-[(9S)-9-[2-(2-ethoxy-2-oxoethoxy)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
|---|---|
| PubChem CID | 78582003 |
| Molecular Formula | C32H30N2O8S2 |
| Molecular Weight | 634.73 g/mol |
| Exact Mass | 634.14 |
| IUPAC Name | ethyl 4-[(9S)-9-[2-(2-ethoxy-2-oxoethoxy)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
| SMILES | CCOC(=O)COc1ccccc1C1c2sc(=O)[nH]c2SC2C3CC(C4C(=O)N(c5ccc(C(=O)OCC)cc5)C(=O)C34)C12 |
| InChI | InChI=1S/C32H30N2O8S2/c1-3-40-21(35)14-42-20-8-6-5-7-17(20)22-23-18-13-19(26(23)43-28-27(22)44-32(39)33-28)25-24(18)29(36)34(30(25)37)16-11-9-15(10-12-16)31(38)41-4-2/h5-12,18-19,22-26H,3-4,13-14H2,1-2H3,(H,33,39) |
| InChIKey | RCBLBKPLURNAHF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 132.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.73 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|