C29H26N2O6S2 — CID 78582117
ethyl 2-[4-[(9S)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetate (PubChem CID 78582117) has the molecular formula C29H26N2O6S2 and a molecular weight of 562.67 g/mol. Its IUPAC name is ethyl 2-[4-[(9S)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[(9S)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 78582117 |
| Molecular Formula | C29H26N2O6S2 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.12 |
| IUPAC Name | ethyl 2-[4-[(9S)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(c6ccccc6)C(=O)C45)C23)cc1 |
| InChI | InChI=1S/C29H26N2O6S2/c1-2-36-19(32)13-37-16-10-8-14(9-11-16)20-21-17-12-18(24(21)38-26-25(20)39-29(35)30-26)23-22(17)27(33)31(28(23)34)15-6-4-3-5-7-15/h3-11,17-18,20-24H,2,12-13H2,1H3,(H,30,35) |
| InChIKey | JYOZXMHWLMCUPM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 105.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|