C31H30N2O7S2 — CID 19253372
ethyl 2-[2-ethoxy-4-[(1R,2R,9R,10R,11S,12S,16R)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetate (PubChem CID 19253372) has the molecular formula C31H30N2O7S2 and a molecular weight of 606.72 g/mol. Its IUPAC name is ethyl 2-[2-ethoxy-4-[(1R,2R,9R,10R,11S,12S,16R)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-ethoxy-4-[(1R,2R,9R,10R,11S,12S,16R)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 19253372 |
| Molecular Formula | C31H30N2O7S2 |
| Molecular Weight | 606.72 g/mol |
| Exact Mass | 606.15 |
| IUPAC Name | ethyl 2-[2-ethoxy-4-[(1R,2R,9R,10R,11S,12S,16R)-6,13,15-trioxo-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-9-yl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc([C@@H]2c3sc(=O)[nH]c3S[C@@H]3[C@@H]4C[C@@H]([C@@H]5C(=O)N(c6ccccc6)C(=O)[C@@H]45)[C@H]23)cc1OCC |
| InChI | InChI=1S/C31H30N2O7S2/c1-3-38-20-12-15(10-11-19(20)40-14-21(34)39-4-2)22-23-17-13-18(26(23)41-28-27(22)42-31(37)32-28)25-24(17)29(35)33(30(25)36)16-8-6-5-7-9-16/h5-12,17-18,22-26H,3-4,13-14H2,1-2H3,(H,32,37)/t17-,18-,22+,23-,24+,25+,26-/m1/s1 |
| InChIKey | HBAVFFPLFGTEIH-IAHIEGPTSA-N |
| XLogP | 4.45 |
| TPSA | 115.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.72 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|