C36H37N3O9S2 — CID 78582142
ethyl 4-[(9S)-9-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate (PubChem CID 78582142) has the molecular formula C36H37N3O9S2 and a molecular weight of 719.84 g/mol. Its IUPAC name is ethyl 4-[(9S)-9-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate.
| Compound Name | ethyl 4-[(9S)-9-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
|---|---|
| PubChem CID | 78582142 |
| Molecular Formula | C36H37N3O9S2 |
| Molecular Weight | 719.84 g/mol |
| Exact Mass | 719.20 |
| IUPAC Name | ethyl 4-[(9S)-9-[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3C4CC(C3C2=O)C2C(c3ccc(OCC(=O)N5CCOCC5)c(OCC)c3)c3sc(=O)[nH]c3SC42)cc1 |
| InChI | InChI=1S/C36H37N3O9S2/c1-3-46-24-15-19(7-10-23(24)48-17-25(40)38-11-13-45-14-12-38)26-27-21-16-22(30(27)49-32-31(26)50-36(44)37-32)29-28(21)33(41)39(34(29)42)20-8-5-18(6-9-20)35(43)47-4-2/h5-10,15,21-22,26-30H,3-4,11-14,16-17H2,1-2H3,(H,37,44) |
| InChIKey | MSLONCODIOWFGH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 144.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.84 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|