C33H33N3O7S2 — CID 43850426
(1R,9S,11S)-9-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-14-(4-methylphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 43850426) has the molecular formula C33H33N3O7S2 and a molecular weight of 647.77 g/mol. Its IUPAC name is (1R,9S,11S)-9-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-14-(4-methylphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (1R,9S,11S)-9-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-14-(4-methylphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 43850426 |
| Molecular Formula | C33H33N3O7S2 |
| Molecular Weight | 647.77 g/mol |
| Exact Mass | 647.18 |
| IUPAC Name | (1R,9S,11S)-9-[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-14-(4-methylphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | COc1cc([C@H]2c3sc(=O)[nH]c3SC3C2[C@H]2C[C@@H]3C3C(=O)N(c4ccc(C)cc4)C(=O)C32)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C33H33N3O7S2/c1-16-3-6-18(7-4-16)36-31(38)26-19-14-20(27(26)32(36)39)28-25(19)24(29-30(44-28)34-33(40)45-29)17-5-8-21(22(13-17)41-2)43-15-23(37)35-9-11-42-12-10-35/h3-8,13,19-20,24-28H,9-12,14-15H2,1-2H3,(H,34,40)/t19-,20-,24-,25?,26?,27?,28?/m1/s1 |
| InChIKey | USBISSYHYLOOLQ-ZEFGVQTPSA-N |
| XLogP | 3.67 |
| TPSA | 118.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.77 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|