C34H34ClN3O6S2 — CID 43850695
(1R,9S,11S)-14-(4-chlorophenyl)-9-[3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 43850695) has the molecular formula C34H34ClN3O6S2 and a molecular weight of 680.25 g/mol. Its IUPAC name is (1R,9S,11S)-14-(4-chlorophenyl)-9-[3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (1R,9S,11S)-14-(4-chlorophenyl)-9-[3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 43850695 |
| Molecular Formula | C34H34ClN3O6S2 |
| Molecular Weight | 680.25 g/mol |
| Exact Mass | 679.16 |
| IUPAC Name | (1R,9S,11S)-14-(4-chlorophenyl)-9-[3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | CCOc1cc([C@H]2c3sc(=O)[nH]c3SC3C2[C@H]2C[C@@H]3C3C(=O)N(c4ccc(Cl)cc4)C(=O)C32)ccc1OCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C34H34ClN3O6S2/c1-2-43-23-14-17(6-11-22(23)44-16-24(39)37-12-4-3-5-13-37)25-26-20-15-21(29(26)45-31-30(25)46-34(42)36-31)28-27(20)32(40)38(33(28)41)19-9-7-18(35)8-10-19/h6-11,14,20-21,25-29H,2-5,12-13,15-16H2,1H3,(H,36,42)/t20-,21-,25-,26?,27?,28?,29?/m1/s1 |
| InChIKey | KUBAJCXIXIAZKC-SKRGYXOGSA-N |
| XLogP | 5.56 |
| TPSA | 109.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.25 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|