C26H17Cl2F3N2O3S2 — CID 78579099
(9S)-9-(2,3-dichlorophenyl)-14-[2-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 78579099) has the molecular formula C26H17Cl2F3N2O3S2 and a molecular weight of 597.47 g/mol. Its IUPAC name is (9S)-9-(2,3-dichlorophenyl)-14-[2-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (9S)-9-(2,3-dichlorophenyl)-14-[2-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 78579099 |
| Molecular Formula | C26H17Cl2F3N2O3S2 |
| Molecular Weight | 597.47 g/mol |
| Exact Mass | 596.00 |
| IUPAC Name | (9S)-9-(2,3-dichlorophenyl)-14-[2-(trifluoromethyl)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | O=C1C2C3CC(C2C(=O)N1c1ccccc1C(F)(F)F)C1C(c2cccc(Cl)c2Cl)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C26H17Cl2F3N2O3S2/c27-13-6-3-4-9(19(13)28)15-16-10-8-11(20(16)37-22-21(15)38-25(36)32-22)18-17(10)23(34)33(24(18)35)14-7-2-1-5-12(14)26(29,30)31/h1-7,10-11,15-18,20H,8H2,(H,32,36) |
| InChIKey | QTVDTNWZECIEFI-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.47 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|